C16H22N4O2 — CID 122582884
3,3a,4,6-tetrakis(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122582884) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3,3a,4,6-tetrakis(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3,3a,4,6-tetrakis(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122582884 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3,3a,4,6-tetrakis(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)N(CC=C)C2(CC=C)C1NC(=O)N2CC=C |
| InChI | InChI=1S/C16H22N4O2/c1-5-9-16-13(17-14(21)19(16)11-7-3)18(10-6-2)15(22)20(16)12-8-4/h5-8,13H,1-4,9-12H2,(H,17,21) |
| InChIKey | CIXJYLUVWWVWBN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|