C12H18N4O2 — CID 122583248
3a,6a-dimethyl-3,6-bis(prop-2-enyl)-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122583248) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3a,6a-dimethyl-3,6-bis(prop-2-enyl)-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3a,6a-dimethyl-3,6-bis(prop-2-enyl)-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122583248 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3a,6a-dimethyl-3,6-bis(prop-2-enyl)-1,4-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)NC2(C)N(CC=C)C(=O)NC12C |
| InChI | InChI=1S/C12H18N4O2/c1-5-7-15-9(17)13-12(4)11(15,3)14-10(18)16(12)8-6-2/h5-6H,1-2,7-8H2,3-4H3,(H,13,17)(H,14,18) |
| InChIKey | HLLNVPLXDXROPL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|