C14H20N4O2 — CID 122583250
3a-methyl-3,4,6-tris(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122583250) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3a-methyl-3,4,6-tris(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3a-methyl-3,4,6-tris(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122583250 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3a-methyl-3,4,6-tris(prop-2-enyl)-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)N(CC=C)C2(C)C1NC(=O)N2CC=C |
| InChI | InChI=1S/C14H20N4O2/c1-5-8-16-11-14(4,18(10-7-3)13(16)20)17(9-6-2)12(19)15-11/h5-7,11H,1-3,8-10H2,4H3,(H,15,19) |
| InChIKey | REZAAHBFRWMIQY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|