C8H12N4O2 — CID 122583262
3a-methyl-6-prop-2-enyl-1,3,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122583262) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3a-methyl-6-prop-2-enyl-1,3,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3a-methyl-6-prop-2-enyl-1,3,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122583262 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3a-methyl-6-prop-2-enyl-1,3,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)NC2(C)NC(=O)NC12 |
| InChI | InChI=1S/C8H12N4O2/c1-3-4-12-5-8(2,11-7(12)14)10-6(13)9-5/h3,5H,1,4H2,2H3,(H,11,14)(H2,9,10,13) |
| InChIKey | ZCNWGYYNCVSVMC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|