C11H16N4O2 — CID 122583263
3a-methyl-4,6-bis(prop-2-enyl)-3,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione (PubChem CID 122583263) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3a-methyl-4,6-bis(prop-2-enyl)-3,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3a-methyl-4,6-bis(prop-2-enyl)-3,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 122583263 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3a-methyl-4,6-bis(prop-2-enyl)-3,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)N(CC=C)C2(C)NC(=O)NC12 |
| InChI | InChI=1S/C11H16N4O2/c1-4-6-14-8-11(3,13-9(16)12-8)15(7-5-2)10(14)17/h4-5,8H,1-2,6-7H2,3H3,(H2,12,13,16) |
| InChIKey | HSPPXBZRNDKPBA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|