C25H31N3O4 — CID 122583290
tert-butyl-[1-cyclopropyl-3-(4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypropan-2-yl]carbamic acid (PubChem CID 122583290) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is tert-butyl-[1-cyclopropyl-3-(4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[1-cyclopropyl-3-(4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 122583290 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl-[1-cyclopropyl-3-(4,6-dimethyl-5-oxobenzo[c][2,7]naphthyridin-8-yl)oxypropan-2-yl]carbamic acid |
| SMILES | Cc1nccc2c1c(=O)n(C)c1cc(OCC(CC3CC3)N(C(=O)O)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C25H31N3O4/c1-15-22-20(10-11-26-15)19-9-8-18(13-21(19)27(5)23(22)29)32-14-17(12-16-6-7-16)28(24(30)31)25(2,3)4/h8-11,13,16-17H,6-7,12,14H2,1-5H3,(H,30,31) |
| InChIKey | WSCWETFBJITBSM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|