About 1-bromo-2,3-diiodocyclohexane
1-bromo-2,3-diiodocyclohexane (PubChem CID 122583561) has the molecular formula C6H9BrI2
and a molecular weight of 414.85 g/mol. Its IUPAC name is 1-bromo-2,3-diiodocyclohexane.
Molecular Properties
| Compound Name | 1-bromo-2,3-diiodocyclohexane |
| PubChem CID | 122583561 |
| Molecular Formula | C6H9BrI2 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 413.80 |
| IUPAC Name | 1-bromo-2,3-diiodocyclohexane |
| SMILES | BrC1CCCC(I)C1I |
| InChI | InChI=1S/C6H9BrI2/c7-4-2-1-3-5(8)6(4)9/h4-6H,1-3H2 |
| InChIKey | JWBWCUUTCUXFRY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3-diiodocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-diiodocyclohexane?
The IUPAC name of 1-bromo-2,3-diiodocyclohexane (CID 122583561) is 1-bromo-2,3-diiodocyclohexane.
What is the SMILES notation for 1-bromo-2,3-diiodocyclohexane?
The canonical SMILES for 1-bromo-2,3-diiodocyclohexane is BrC1CCCC(I)C1I.
What is the InChIKey of 1-bromo-2,3-diiodocyclohexane?
The InChIKey is JWBWCUUTCUXFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrI2/c7-4-2-1-3-5(8)6(4)9/h4-6H,1-3H2.
What are the key properties of 1-bromo-2,3-diiodocyclohexane?
1-bromo-2,3-diiodocyclohexane has a molecular weight of 414.85 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-diiodocyclohexane is sourced from PubChem (CID 122583561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).