About 1,2,3-triiodocyclopentane
1,2,3-triiodocyclopentane (PubChem CID 122583562) has the molecular formula C5H7I3
and a molecular weight of 447.82 g/mol. Its IUPAC name is 1,2,3-triiodocyclopentane.
Molecular Properties
| Compound Name | 1,2,3-triiodocyclopentane |
| PubChem CID | 122583562 |
| Molecular Formula | C5H7I3 |
| Molecular Weight | 447.82 g/mol |
| Exact Mass | 447.77 |
| IUPAC Name | 1,2,3-triiodocyclopentane |
| SMILES | IC1CCC(I)C1I |
| InChI | InChI=1S/C5H7I3/c6-3-1-2-4(7)5(3)8/h3-5H,1-2H2 |
| InChIKey | PPHXVPMSQGDBFA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-triiodocyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-triiodocyclopentane?
The IUPAC name of 1,2,3-triiodocyclopentane (CID 122583562) is 1,2,3-triiodocyclopentane.
What is the SMILES notation for 1,2,3-triiodocyclopentane?
The canonical SMILES for 1,2,3-triiodocyclopentane is IC1CCC(I)C1I.
What is the InChIKey of 1,2,3-triiodocyclopentane?
The InChIKey is PPHXVPMSQGDBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7I3/c6-3-1-2-4(7)5(3)8/h3-5H,1-2H2.
What are the key properties of 1,2,3-triiodocyclopentane?
1,2,3-triiodocyclopentane has a molecular weight of 447.82 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-triiodocyclopentane is sourced from PubChem (CID 122583562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).