About 1-bromo-3,5-diiodocycloheptane
1-bromo-3,5-diiodocycloheptane (PubChem CID 122583758) has the molecular formula C7H11BrI2
and a molecular weight of 428.88 g/mol. Its IUPAC name is 1-bromo-3,5-diiodocycloheptane.
Molecular Properties
| Compound Name | 1-bromo-3,5-diiodocycloheptane |
| PubChem CID | 122583758 |
| Molecular Formula | C7H11BrI2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 427.81 |
| IUPAC Name | 1-bromo-3,5-diiodocycloheptane |
| SMILES | BrC1CCC(I)CC(I)C1 |
| InChI | InChI=1S/C7H11BrI2/c8-5-1-2-6(9)4-7(10)3-5/h5-7H,1-4H2 |
| InChIKey | ATSPMLHINIOUOA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,5-diiodocycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-diiodocycloheptane?
The IUPAC name of 1-bromo-3,5-diiodocycloheptane (CID 122583758) is 1-bromo-3,5-diiodocycloheptane.
What is the SMILES notation for 1-bromo-3,5-diiodocycloheptane?
The canonical SMILES for 1-bromo-3,5-diiodocycloheptane is BrC1CCC(I)CC(I)C1.
What is the InChIKey of 1-bromo-3,5-diiodocycloheptane?
The InChIKey is ATSPMLHINIOUOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrI2/c8-5-1-2-6(9)4-7(10)3-5/h5-7H,1-4H2.
What are the key properties of 1-bromo-3,5-diiodocycloheptane?
1-bromo-3,5-diiodocycloheptane has a molecular weight of 428.88 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-diiodocycloheptane is sourced from PubChem (CID 122583758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).