About (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol (PubChem CID 122585004) has the molecular formula C13H19N5O
and a molecular weight of 261.33 g/mol. Its IUPAC name is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol |
| PubChem CID | 122585004 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol |
| SMILES | CCC[C@](C)(CO)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C13H19N5O/c1-3-6-13(2,8-19)18-11-10-9(5-4-7-15-10)16-12(14)17-11/h4-5,7,19H,3,6,8H2,1-2H3,(H3,14,16,17,18)/t13-/m1/s1 |
| InChIKey | DWWHPHBWOURHEZ-CYBMUJFWSA-N |
| XLogP | 1.57 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol?
The IUPAC name of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol (CID 122585004) is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol.
What is the SMILES notation for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol?
The canonical SMILES for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol is CCC[C@](C)(CO)Nc1nc(N)nc2cccnc12.
What is the InChIKey of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol?
The InChIKey is DWWHPHBWOURHEZ-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H19N5O/c1-3-6-13(2,8-19)18-11-10-9(5-4-7-15-10)16-12(14)17-11/h4-5,7,19H,3,6,8H2,1-2H3,(H3,14,16,17,18)/t13-/m1/s1.
What are the key properties of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol?
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol has a molecular weight of 261.33 g/mol, XLogP of 1.57, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylpentan-1-ol is sourced from PubChem (CID 122585004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).