C13H19N5O — CID 122585158
(2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 122585158) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is (2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol.
| Compound Name | (2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 122585158 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | CCCC[C@@H](CO)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C13H19N5O/c1-2-3-5-9(8-19)16-12-11-10(6-4-7-15-11)17-13(14)18-12/h4,6-7,9,19H,2-3,5,8H2,1H3,(H3,14,16,17,18)/t9-/m0/s1 |
| InChIKey | CYONUIQGZDGWMR-VIFPVBQESA-N |
| XLogP | 1.57 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |