About (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol (PubChem CID 122585192) has the molecular formula C14H19N5O
and a molecular weight of 273.34 g/mol. Its IUPAC name is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol |
| PubChem CID | 122585192 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol |
| SMILES | C=C(C)CC[C@H](CO)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C14H19N5O/c1-9(2)5-6-10(8-20)17-13-12-11(4-3-7-16-12)18-14(15)19-13/h3-4,7,10,20H,1,5-6,8H2,2H3,(H3,15,17,18,19)/t10-/m1/s1 |
| InChIKey | JTAJIAZGINMUBK-SNVBAGLBSA-N |
| XLogP | 1.74 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol?
The IUPAC name of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol (CID 122585192) is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol.
What is the SMILES notation for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol?
The canonical SMILES for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol is C=C(C)CC[C@H](CO)Nc1nc(N)nc2cccnc12.
What is the InChIKey of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol?
The InChIKey is JTAJIAZGINMUBK-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H19N5O/c1-9(2)5-6-10(8-20)17-13-12-11(4-3-7-16-12)18-14(15)19-13/h3-4,7,10,20H,1,5-6,8H2,2H3,(H3,15,17,18,19)/t10-/m1/s1.
What are the key properties of (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol?
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol has a molecular weight of 273.34 g/mol, XLogP of 1.74, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-5-methylhex-5-en-1-ol is sourced from PubChem (CID 122585192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).