C28H33N5O8 — CID 122585668
(2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-6-[(2-methoxy-4-nitrophenyl)diazenyl]-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate (PubChem CID 122585668) has the molecular formula C28H33N5O8 and a molecular weight of 567.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-6-[(2-methoxy-4-nitrophenyl)diazenyl]-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-6-[(2-methoxy-4-nitrophenyl)diazenyl]-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate |
|---|---|
| PubChem CID | 122585668 |
| Molecular Formula | C28H33N5O8 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-6-[(2-methoxy-4-nitrophenyl)diazenyl]-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1/N=N/c1cc2c(cc1OC)N(CCCC(=O)ON1C(=O)CCC1=O)C(C)(C)CC2C |
| InChI | InChI=1S/C28H33N5O8/c1-17-16-28(2,3)31(12-6-7-27(36)41-32-25(34)10-11-26(32)35)22-15-24(40-5)21(14-19(17)22)30-29-20-9-8-18(33(37)38)13-23(20)39-4/h8-9,13-15,17H,6-7,10-12,16H2,1-5H3/b30-29+ |
| InChIKey | RQOHWNFCLDGMPT-QVIHXGFCSA-N |
| XLogP | 5.51 |
| TPSA | 153.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|