C27H31N5O7 — CID 122585671
(2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-2,2,4-trimethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydroquinolin-1-yl]butanoate (PubChem CID 122585671) has the molecular formula C27H31N5O7 and a molecular weight of 537.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-2,2,4-trimethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydroquinolin-1-yl]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-2,2,4-trimethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydroquinolin-1-yl]butanoate |
|---|---|
| PubChem CID | 122585671 |
| Molecular Formula | C27H31N5O7 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[7-methoxy-2,2,4-trimethyl-6-[(4-nitrophenyl)diazenyl]-3,4-dihydroquinolin-1-yl]butanoate |
| SMILES | COc1cc2c(cc1/N=N/c1ccc([N+](=O)[O-])cc1)C(C)CC(C)(C)N2CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H31N5O7/c1-17-16-27(2,3)30(13-5-6-26(35)39-31-24(33)11-12-25(31)34)22-15-23(38-4)21(14-20(17)22)29-28-18-7-9-19(10-8-18)32(36)37/h7-10,14-15,17H,5-6,11-13,16H2,1-4H3/b29-28+ |
| InChIKey | AMPKCRBWTROWSP-ZQHSETAFSA-N |
| XLogP | 5.50 |
| TPSA | 144.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|