C27H39FN2O2 — CID 122586426
3-[4-[bis(2-methylpropyl)amino]-3-(4-ethylanilino)-5-fluorophenyl]pentanoic acid (PubChem CID 122586426) has the molecular formula C27H39FN2O2 and a molecular weight of 442.62 g/mol. Its IUPAC name is 3-[4-[bis(2-methylpropyl)amino]-3-(4-ethylanilino)-5-fluorophenyl]pentanoic acid.
| Compound Name | 3-[4-[bis(2-methylpropyl)amino]-3-(4-ethylanilino)-5-fluorophenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586426 |
| Molecular Formula | C27H39FN2O2 |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 3-[4-[bis(2-methylpropyl)amino]-3-(4-ethylanilino)-5-fluorophenyl]pentanoic acid |
| SMILES | CCc1ccc(Nc2cc(C(CC)CC(=O)O)cc(F)c2N(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C27H39FN2O2/c1-7-20-9-11-23(12-10-20)29-25-14-22(21(8-2)15-26(31)32)13-24(28)27(25)30(16-18(3)4)17-19(5)6/h9-14,18-19,21,29H,7-8,15-17H2,1-6H3,(H,31,32) |
| InChIKey | QRUGOINPNHOSPL-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |