C21H25NO12 — CID 122587860
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-[(4-nitrophenyl)methyl]oxan-2-yl]methyl acetate (PubChem CID 122587860) has the molecular formula C21H25NO12 and a molecular weight of 483.43 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-[(4-nitrophenyl)methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-[(4-nitrophenyl)methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122587860 |
| Molecular Formula | C21H25NO12 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-[(4-nitrophenyl)methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@](O)(Cc2ccc([N+](=O)[O-])cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO12/c1-11(23)30-10-17-18(31-12(2)24)19(32-13(3)25)20(33-14(4)26)21(27,34-17)9-15-5-7-16(8-6-15)22(28)29/h5-8,17-20,27H,9-10H2,1-4H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | CQKFPVDSSRXOHX-XDWAVFMPSA-N |
| XLogP | 0.58 |
| TPSA | 177.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|