About 1,3-benzothiazole;1,2-benzoxazole
1,3-benzothiazole;1,2-benzoxazole (PubChem CID 122587912) has the molecular formula C14H10N2OS
and a molecular weight of 254.31 g/mol. Its IUPAC name is 1,3-benzothiazole;1,2-benzoxazole.
Molecular Properties
| Compound Name | 1,3-benzothiazole;1,2-benzoxazole |
| PubChem CID | 122587912 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1,3-benzothiazole;1,2-benzoxazole |
| SMILES | c1ccc2oncc2c1.c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NO.C7H5NS/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-7-6(3-1)8-5-9-7/h2*1-5H |
| InChIKey | JZAJYPLYYMWYTF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzothiazole;1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole;1,2-benzoxazole?
The IUPAC name of 1,3-benzothiazole;1,2-benzoxazole (CID 122587912) is 1,3-benzothiazole;1,2-benzoxazole.
What is the SMILES notation for 1,3-benzothiazole;1,2-benzoxazole?
The canonical SMILES for 1,3-benzothiazole;1,2-benzoxazole is c1ccc2oncc2c1.c1ccc2scnc2c1.
What is the InChIKey of 1,3-benzothiazole;1,2-benzoxazole?
The InChIKey is JZAJYPLYYMWYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C7H5NS/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-7-6(3-1)8-5-9-7/h2*1-5H.
What are the key properties of 1,3-benzothiazole;1,2-benzoxazole?
1,3-benzothiazole;1,2-benzoxazole has a molecular weight of 254.31 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole;1,2-benzoxazole is sourced from PubChem (CID 122587912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).