C22H35FN2O2 — CID 122588103
methyl 3-[3-amino-4-[(1-cyclohexyl-2-methylpropyl)amino]-5-fluorophenyl]pentanoate (PubChem CID 122588103) has the molecular formula C22H35FN2O2 and a molecular weight of 378.53 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[(1-cyclohexyl-2-methylpropyl)amino]-5-fluorophenyl]pentanoate.
| Compound Name | methyl 3-[3-amino-4-[(1-cyclohexyl-2-methylpropyl)amino]-5-fluorophenyl]pentanoate |
|---|---|
| PubChem CID | 122588103 |
| Molecular Formula | C22H35FN2O2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | methyl 3-[3-amino-4-[(1-cyclohexyl-2-methylpropyl)amino]-5-fluorophenyl]pentanoate |
| SMILES | CCC(CC(=O)OC)c1cc(N)c(NC(C(C)C)C2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C22H35FN2O2/c1-5-15(13-20(26)27-4)17-11-18(23)22(19(24)12-17)25-21(14(2)3)16-9-7-6-8-10-16/h11-12,14-16,21,25H,5-10,13,24H2,1-4H3 |
| InChIKey | OKYMYINDZIWKHX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|