C40H35F2N5O — CID 122588776
2-[3-[2-(1,1-difluoroethyl)-4-pyridinyl]-1-tritylindazol-5-yl]-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 122588776) has the molecular formula C40H35F2N5O and a molecular weight of 639.75 g/mol. Its IUPAC name is 2-[3-[2-(1,1-difluoroethyl)-4-pyridinyl]-1-tritylindazol-5-yl]-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 2-[3-[2-(1,1-difluoroethyl)-4-pyridinyl]-1-tritylindazol-5-yl]-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 122588776 |
| Molecular Formula | C40H35F2N5O |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | 2-[3-[2-(1,1-difluoroethyl)-4-pyridinyl]-1-tritylindazol-5-yl]-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | CC(F)(F)c1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(N4CCC5(CCNC5)C4=O)cc23)ccn1 |
| InChI | InChI=1S/C40H35F2N5O/c1-38(41,42)35-25-28(19-22-44-35)36-33-26-32(46-24-21-39(37(46)48)20-23-43-27-39)17-18-34(33)47(45-36)40(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-19,22,25-26,43H,20-21,23-24,27H2,1H3 |
| InChIKey | YWOFIJSQEGSGNS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|