About 2(5H)-Furanone, 3-(bromomethyl)-
2(5H)-Furanone, 3-(bromomethyl)- (PubChem CID 12258901) has the molecular formula C5H5BrO2
and a molecular weight of 177.00 g/mol. Its IUPAC name is 4-(bromomethyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 2(5H)-Furanone, 3-(bromomethyl)- |
| PubChem CID | 12258901 |
| Molecular Formula | C5H5BrO2 |
| Molecular Weight | 177.00 g/mol |
| Exact Mass | 175.95 |
| IUPAC Name | 4-(bromomethyl)-2H-furan-5-one |
| SMILES | C1C=C(C(=O)O1)CBr |
| InChI | InChI=1S/C5H5BrO2/c6-3-4-1-2-8-5(4)7/h1H,2-3H2 |
| InChIKey | QRKZLCZRWJJOFS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | 139 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.00 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2(5H)-Furanone, 3-(bromomethyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2(5H)-Furanone, 3-(bromomethyl)-?
The IUPAC name of 2(5H)-Furanone, 3-(bromomethyl)- (CID 12258901) is 4-(bromomethyl)-2H-furan-5-one.
What is the SMILES notation for 2(5H)-Furanone, 3-(bromomethyl)-?
The canonical SMILES for 2(5H)-Furanone, 3-(bromomethyl)- is C1C=C(C(=O)O1)CBr.
What is the InChIKey of 2(5H)-Furanone, 3-(bromomethyl)-?
The InChIKey is QRKZLCZRWJJOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrO2/c6-3-4-1-2-8-5(4)7/h1H,2-3H2.
What are the key properties of 2(5H)-Furanone, 3-(bromomethyl)-?
2(5H)-Furanone, 3-(bromomethyl)- has a molecular weight of 177.00 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2(5H)-Furanone, 3-(bromomethyl)- is sourced from PubChem (CID 12258901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).