C16H11F4N5O3S — CID 122589020
N-[5-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]-4,6-dimethoxypyrimidine-5-carboxamide (PubChem CID 122589020) has the molecular formula C16H11F4N5O3S and a molecular weight of 429.36 g/mol. Its IUPAC name is N-[5-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]-4,6-dimethoxypyrimidine-5-carboxamide.
| Compound Name | N-[5-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]-4,6-dimethoxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122589020 |
| Molecular Formula | C16H11F4N5O3S |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | N-[5-(6-fluoro-3-pyridinyl)-4-(trifluoromethyl)-1,3-thiazol-2-yl]-4,6-dimethoxypyrimidine-5-carboxamide |
| SMILES | COc1ncnc(OC)c1C(=O)Nc1nc(C(F)(F)F)c(-c2ccc(F)nc2)s1 |
| InChI | InChI=1S/C16H11F4N5O3S/c1-27-13-9(14(28-2)23-6-22-13)12(26)25-15-24-11(16(18,19)20)10(29-15)7-3-4-8(17)21-5-7/h3-6H,1-2H3,(H,24,25,26) |
| InChIKey | AOSXFZLWFUSZEF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|