C13H19N5O6 — CID 122589197
[(2S,4Z,5S)-4-(2-amino-2-oxoethoxy)imino-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylcarbamic acid (PubChem CID 122589197) has the molecular formula C13H19N5O6 and a molecular weight of 341.32 g/mol. Its IUPAC name is [(2S,4Z,5S)-4-(2-amino-2-oxoethoxy)imino-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylcarbamic acid.
| Compound Name | [(2S,4Z,5S)-4-(2-amino-2-oxoethoxy)imino-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 122589197 |
| Molecular Formula | C13H19N5O6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [(2S,4Z,5S)-4-(2-amino-2-oxoethoxy)imino-7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]methylcarbamic acid |
| SMILES | C=CCON1C(=O)N2C[C@H]1/C(=N\OCC(N)=O)C[C@H]2CNC(=O)O |
| InChI | InChI=1S/C13H19N5O6/c1-2-3-24-18-10-6-17(13(18)22)8(5-15-12(20)21)4-9(10)16-23-7-11(14)19/h2,8,10,15H,1,3-7H2,(H2,14,19)(H,20,21)/b16-9-/t8-,10-/m0/s1 |
| InChIKey | PPQGGZHXBGPQGO-FYGQBWNHSA-N |
| XLogP | -0.89 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|