About N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine
N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine (PubChem CID 122589652) has the molecular formula C17H10F3N5
and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine.
Molecular Properties
| Compound Name | N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine |
| PubChem CID | 122589652 |
| Molecular Formula | C17H10F3N5 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine |
| SMILES | Fc1ccc(-c2ncc(F)c(Nc3ccc4[nH]ncc4c3)n2)cc1F |
| InChI | InChI=1S/C17H10F3N5/c18-12-3-1-9(6-13(12)19)16-21-8-14(20)17(24-16)23-11-2-4-15-10(5-11)7-22-25-15/h1-8H,(H,22,25)(H,21,23,24) |
| InChIKey | JAAKWWBDRAOYJY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine?
The IUPAC name of N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine (CID 122589652) is N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine.
What is the SMILES notation for N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine?
The canonical SMILES for N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine is Fc1ccc(-c2ncc(F)c(Nc3ccc4[nH]ncc4c3)n2)cc1F.
What is the InChIKey of N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine?
The InChIKey is JAAKWWBDRAOYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3N5/c18-12-3-1-9(6-13(12)19)16-21-8-14(20)17(24-16)23-11-2-4-15-10(5-11)7-22-25-15/h1-8H,(H,22,25)(H,21,23,24).
What are the key properties of N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine?
N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine has a molecular weight of 341.30 g/mol, XLogP of 4.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-difluorophenyl)-5-fluoropyrimidin-4-yl]-1H-indazol-5-amine is sourced from PubChem (CID 122589652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).