C19H13ClF2N4 — CID 122589989
1-[2-(3-chloro-2,4-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]indazole (PubChem CID 122589989) has the molecular formula C19H13ClF2N4 and a molecular weight of 370.79 g/mol. Its IUPAC name is 1-[2-(3-chloro-2,4-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]indazole.
| Compound Name | 1-[2-(3-chloro-2,4-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]indazole |
|---|---|
| PubChem CID | 122589989 |
| Molecular Formula | C19H13ClF2N4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-[2-(3-chloro-2,4-difluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]indazole |
| SMILES | Fc1ccc(-c2nn3c(c2-n2ncc4ccccc42)CCC3)c(F)c1Cl |
| InChI | InChI=1S/C19H13ClF2N4/c20-16-13(21)8-7-12(17(16)22)18-19(15-6-3-9-25(15)24-18)26-14-5-2-1-4-11(14)10-23-26/h1-2,4-5,7-8,10H,3,6,9H2 |
| InChIKey | JAYNIVIHCXMKET-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|