C13H24ClN5O — CID 122590128
6-chloro-N-cyclohexyl-3-morpholin-4-yl-2,4-dihydro-1,3,5-triazin-1-amine (PubChem CID 122590128) has the molecular formula C13H24ClN5O and a molecular weight of 301.82 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-3-morpholin-4-yl-2,4-dihydro-1,3,5-triazin-1-amine.
| Compound Name | 6-chloro-N-cyclohexyl-3-morpholin-4-yl-2,4-dihydro-1,3,5-triazin-1-amine |
|---|---|
| PubChem CID | 122590128 |
| Molecular Formula | C13H24ClN5O |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 6-chloro-N-cyclohexyl-3-morpholin-4-yl-2,4-dihydro-1,3,5-triazin-1-amine |
| SMILES | ClC1=NCN(N2CCOCC2)CN1NC1CCCCC1 |
| InChI | InChI=1S/C13H24ClN5O/c14-13-15-10-18(17-6-8-20-9-7-17)11-19(13)16-12-4-2-1-3-5-12/h12,16H,1-11H2 |
| InChIKey | MDXMTKMLQWYBPD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|