C29H40Cl2N2O4 — CID 122590274
2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide;2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide (PubChem CID 122590274) has the molecular formula C29H40Cl2N2O4 and a molecular weight of 551.56 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide;2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide.
| Compound Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide;2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide |
|---|---|
| PubChem CID | 122590274 |
| Molecular Formula | C29H40Cl2N2O4 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-methoxyethyl)acetamide;2-chloro-N-(2-ethoxyethyl)-N-(2-methyl-1-phenylprop-1-enyl)acetamide |
| SMILES | CCOCCN(C(=O)CCl)C(=C(C)C)c1ccccc1.COCCN(C(=O)CCl)c1c(C)cccc1C |
| InChI | InChI=1S/C16H22ClNO2.C13H18ClNO2/c1-4-20-11-10-18(15(19)12-17)16(13(2)3)14-8-6-5-7-9-14;1-10-5-4-6-11(2)13(10)15(7-8-17-3)12(16)9-14/h5-9H,4,10-12H2,1-3H3;4-6H,7-9H2,1-3H3 |
| InChIKey | MOIFADZRUOADDM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|