C18H17ClN4O2 — CID 122590639
4-(3-chloro-4-pyridinyl)-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-methoxybenzamide (PubChem CID 122590639) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 4-(3-chloro-4-pyridinyl)-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-methoxybenzamide.
| Compound Name | 4-(3-chloro-4-pyridinyl)-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 122590639 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-(3-chloro-4-pyridinyl)-N-[(3R)-1-cyanopyrrolidin-3-yl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2CCN(C#N)C2)ccc1-c1ccncc1Cl |
| InChI | InChI=1S/C18H17ClN4O2/c1-25-17-8-12(18(24)22-13-5-7-23(10-13)11-20)2-3-15(17)14-4-6-21-9-16(14)19/h2-4,6,8-9,13H,5,7,10H2,1H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | YOHLXLXTZIRRQL-CYBMUJFWSA-N |
| XLogP | 2.70 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|