C17H17N7O — CID 122590706
N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 122590706) has the molecular formula C17H17N7O and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122590706 |
| Molecular Formula | C17H17N7O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(1-methylpyrazol-4-yl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cn1cc(-c2ccc3nc(C(=O)N[C@@H]4CCN(C#N)C4)cn3c2)cn1 |
| InChI | InChI=1S/C17H17N7O/c1-22-7-13(6-19-22)12-2-3-16-21-15(10-24(16)8-12)17(25)20-14-4-5-23(9-14)11-18/h2-3,6-8,10,14H,4-5,9H2,1H3,(H,20,25)/t14-/m1/s1 |
| InChIKey | IEKJTQZFBHSDSZ-CQSZACIVSA-N |
| XLogP | 1.02 |
| TPSA | 91.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|