C15H14F4N4O — CID 122590752
(3aR,6aR)-5-cyano-N-[2-fluoro-4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide (PubChem CID 122590752) has the molecular formula C15H14F4N4O and a molecular weight of 342.30 g/mol. Its IUPAC name is (3aR,6aR)-5-cyano-N-[2-fluoro-4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide.
| Compound Name | (3aR,6aR)-5-cyano-N-[2-fluoro-4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 122590752 |
| Molecular Formula | C15H14F4N4O |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (3aR,6aR)-5-cyano-N-[2-fluoro-4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide |
| SMILES | N#CN1C[C@H]2CCN(C(=O)Nc3ccc(C(F)(F)F)cc3F)[C@H]2C1 |
| InChI | InChI=1S/C15H14F4N4O/c16-11-5-10(15(17,18)19)1-2-12(11)21-14(24)23-4-3-9-6-22(8-20)7-13(9)23/h1-2,5,9,13H,3-4,6-7H2,(H,21,24)/t9-,13+/m1/s1 |
| InChIKey | NKSQYNVJOYRSIC-RNCFNFMXSA-N |
| XLogP | 2.86 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|