C22H24N6O2 — CID 122590757
N-[(3R)-1-cyanopyrrolidin-3-yl]-1-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)indazole-3-carboxamide (PubChem CID 122590757) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-1-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)indazole-3-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-1-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 122590757 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-1-(cyclopropylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)indazole-3-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc2c(C(=O)N[C@@H]3CCN(C#N)C3)nn(CC3CC3)c2c1 |
| InChI | InChI=1S/C22H24N6O2/c1-13-20(14(2)30-26-13)16-5-6-18-19(9-16)28(10-15-3-4-15)25-21(18)22(29)24-17-7-8-27(11-17)12-23/h5-6,9,15,17H,3-4,7-8,10-11H2,1-2H3,(H,24,29)/t17-/m1/s1 |
| InChIKey | CGYUQCMKKVYZJQ-QGZVFWFLSA-N |
| XLogP | 3.00 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|