C18H19FN6O — CID 122590857
(3aR,6aR)-5-cyano-N-[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide (PubChem CID 122590857) has the molecular formula C18H19FN6O and a molecular weight of 354.39 g/mol. Its IUPAC name is (3aR,6aR)-5-cyano-N-[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide.
| Compound Name | (3aR,6aR)-5-cyano-N-[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 122590857 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3aR,6aR)-5-cyano-N-[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide |
| SMILES | Cn1cc(-c2ccc(NC(=O)N3CC[C@@H]4CN(C#N)C[C@@H]43)c(F)c2)cn1 |
| InChI | InChI=1S/C18H19FN6O/c1-23-8-14(7-21-23)12-2-3-16(15(19)6-12)22-18(26)25-5-4-13-9-24(11-20)10-17(13)25/h2-3,6-8,13,17H,4-5,9-10H2,1H3,(H,22,26)/t13-,17+/m1/s1 |
| InChIKey | WGPCDXBJDJWDQB-DYVFJYSZSA-N |
| XLogP | 2.25 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|