C19H20N6O2 — CID 122590884
N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-1H-benzimidazole-2-carboxamide (PubChem CID 122590884) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 122590884 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-1H-benzimidazole-2-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc2nc(C(=O)N(C)[C@@H]3CCN(C#N)C3)[nH]c2c1 |
| InChI | InChI=1S/C19H20N6O2/c1-11-17(12(2)27-23-11)13-4-5-15-16(8-13)22-18(21-15)19(26)24(3)14-6-7-25(9-14)10-20/h4-5,8,14H,6-7,9H2,1-3H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | IJTONWPTRNPZBZ-CQSZACIVSA-N |
| XLogP | 2.46 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|