C15H15F3N4O — CID 122590895
(3aR,6aR)-5-cyano-N-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide (PubChem CID 122590895) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is (3aR,6aR)-5-cyano-N-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide.
| Compound Name | (3aR,6aR)-5-cyano-N-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 122590895 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (3aR,6aR)-5-cyano-N-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxamide |
| SMILES | N#CN1C[C@H]2CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)[C@H]2C1 |
| InChI | InChI=1S/C15H15F3N4O/c16-15(17,18)11-1-3-12(4-2-11)20-14(23)22-6-5-10-7-21(9-19)8-13(10)22/h1-4,10,13H,5-8H2,(H,20,23)/t10-,13+/m1/s1 |
| InChIKey | DOIDLBGKYGDVFZ-MFKMUULPSA-N |
| XLogP | 2.72 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|