About 3-methoxy-1,3-oxazol-2-one
3-methoxy-1,3-oxazol-2-one (PubChem CID 122591680) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is 3-methoxy-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 3-methoxy-1,3-oxazol-2-one |
| PubChem CID | 122591680 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 3-methoxy-1,3-oxazol-2-one |
| SMILES | COn1ccoc1=O |
| InChI | InChI=1S/C4H5NO3/c1-7-5-2-3-8-4(5)6/h2-3H,1H3 |
| InChIKey | ZWLIPMVTPXKSHY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1,3-oxazol-2-one?
The IUPAC name of 3-methoxy-1,3-oxazol-2-one (CID 122591680) is 3-methoxy-1,3-oxazol-2-one.
What is the SMILES notation for 3-methoxy-1,3-oxazol-2-one?
The canonical SMILES for 3-methoxy-1,3-oxazol-2-one is COn1ccoc1=O.
What is the InChIKey of 3-methoxy-1,3-oxazol-2-one?
The InChIKey is ZWLIPMVTPXKSHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c1-7-5-2-3-8-4(5)6/h2-3H,1H3.
What are the key properties of 3-methoxy-1,3-oxazol-2-one?
3-methoxy-1,3-oxazol-2-one has a molecular weight of 115.09 g/mol, XLogP of -0.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1,3-oxazol-2-one is sourced from PubChem (CID 122591680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).