About 3-methoxy-1,3-oxazole-2-thione
3-methoxy-1,3-oxazole-2-thione (PubChem CID 122591684) has the molecular formula C4H5NO2S
and a molecular weight of 131.16 g/mol. Its IUPAC name is 3-methoxy-1,3-oxazole-2-thione.
Molecular Properties
| Compound Name | 3-methoxy-1,3-oxazole-2-thione |
| PubChem CID | 122591684 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 3-methoxy-1,3-oxazole-2-thione |
| SMILES | COn1ccoc1=S |
| InChI | InChI=1S/C4H5NO2S/c1-6-5-2-3-7-4(5)8/h2-3H,1H3 |
| InChIKey | UYZXTXKAEVMVPF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 27.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-1,3-oxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1,3-oxazole-2-thione?
The IUPAC name of 3-methoxy-1,3-oxazole-2-thione (CID 122591684) is 3-methoxy-1,3-oxazole-2-thione.
What is the SMILES notation for 3-methoxy-1,3-oxazole-2-thione?
The canonical SMILES for 3-methoxy-1,3-oxazole-2-thione is COn1ccoc1=S.
What is the InChIKey of 3-methoxy-1,3-oxazole-2-thione?
The InChIKey is UYZXTXKAEVMVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S/c1-6-5-2-3-7-4(5)8/h2-3H,1H3.
What are the key properties of 3-methoxy-1,3-oxazole-2-thione?
3-methoxy-1,3-oxazole-2-thione has a molecular weight of 131.16 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1,3-oxazole-2-thione is sourced from PubChem (CID 122591684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).