C9H12INO — CID 122592115
5-ethyl-2-(3-iodocyclobutyl)-1,3-oxazole (PubChem CID 122592115) has the molecular formula C9H12INO and a molecular weight of 277.11 g/mol. Its IUPAC name is 5-ethyl-2-(3-iodocyclobutyl)-1,3-oxazole.
| Compound Name | 5-ethyl-2-(3-iodocyclobutyl)-1,3-oxazole |
|---|---|
| PubChem CID | 122592115 |
| Molecular Formula | C9H12INO |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 5-ethyl-2-(3-iodocyclobutyl)-1,3-oxazole |
| SMILES | CCc1cnc(C2CC(I)C2)o1 |
| InChI | InChI=1S/C9H12INO/c1-2-8-5-11-9(12-8)6-3-7(10)4-6/h5-7H,2-4H2,1H3 |
| InChIKey | IRSRILPEWQEEJB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|