C12H20O6 — CID 122592153
methyl 2-[(3aR,4R,6S)-4-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 122592153) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,6S)-4-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,6S)-4-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 122592153 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | methyl 2-[(3aR,4R,6S)-4-(methoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | COC[C@H]1O[C@@H](CC(=O)OC)C2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H20O6/c1-12(2)17-10-7(5-9(13)15-4)16-8(6-14-3)11(10)18-12/h7-8,10-11H,5-6H2,1-4H3/t7-,8+,10?,11+/m0/s1 |
| InChIKey | OLLHTPQJAVWATC-KWMOECRTSA-N |
| XLogP | 0.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |