C10H10O4 — CID 122592323
(3aS,6aR)-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione (PubChem CID 122592323) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (3aS,6aR)-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione.
| Compound Name | (3aS,6aR)-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione |
|---|---|
| PubChem CID | 122592323 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3aS,6aR)-1,3-bis(ethenyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione |
| SMILES | C=CC1OC(C=C)[C@@H]2C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C10H10O4/c1-3-5-7-8(6(4-2)13-5)10(12)14-9(7)11/h3-8H,1-2H2/t5?,6?,7-,8+ |
| InChIKey | COUXBZATXRFZMG-HYNHDVCUSA-N |
| XLogP | 0.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|