C13H17NO4 — CID 122592455
(3aR,6aS)-1,3-bis(ethenyl)-5-(2-methoxyethyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione (PubChem CID 122592455) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (3aR,6aS)-1,3-bis(ethenyl)-5-(2-methoxyethyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-1,3-bis(ethenyl)-5-(2-methoxyethyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 122592455 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (3aR,6aS)-1,3-bis(ethenyl)-5-(2-methoxyethyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]pyrrole-4,6-dione |
| SMILES | C=CC1OC(C=C)[C@@H]2C(=O)N(CCOC)C(=O)[C@H]12 |
| InChI | InChI=1S/C13H17NO4/c1-4-8-10-11(9(5-2)18-8)13(16)14(12(10)15)6-7-17-3/h4-5,8-11H,1-2,6-7H2,3H3/t8?,9?,10-,11+ |
| InChIKey | OZFCSTXTFRPIFI-HWACXVBKSA-N |
| XLogP | 0.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|