C27H42NO7+ — CID 122592482
[6-[[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-6-oxohexyl]-benzyl-dimethylazanium (PubChem CID 122592482) has the molecular formula C27H42NO7+ and a molecular weight of 492.63 g/mol. Its IUPAC name is [6-[[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-6-oxohexyl]-benzyl-dimethylazanium.
| Compound Name | [6-[[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-6-oxohexyl]-benzyl-dimethylazanium |
|---|---|
| PubChem CID | 122592482 |
| Molecular Formula | C27H42NO7+ |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | [6-[[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]-6-oxohexyl]-benzyl-dimethylazanium |
| SMILES | CC1(C)O[C@H]2OC([C@H]3COC(C)(C)O3)C(OC(=O)CCCCC[N+](C)(C)Cc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C27H42NO7/c1-26(2)30-18-20(33-26)22-23(24-25(32-22)35-27(3,4)34-24)31-21(29)15-11-8-12-16-28(5,6)17-19-13-9-7-10-14-19/h7,9-10,13-14,20,22-25H,8,11-12,15-18H2,1-6H3/q+1/t20-,22?,23?,24-,25-/m1/s1 |
| InChIKey | VPSHBSZDOJKKQA-GSDPCFFASA-N |
| XLogP | 3.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|