About 2-ethynyl-3,4,6-trimethylpyridine
2-ethynyl-3,4,6-trimethylpyridine (PubChem CID 122593451) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-ethynyl-3,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | 2-ethynyl-3,4,6-trimethylpyridine |
| PubChem CID | 122593451 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-ethynyl-3,4,6-trimethylpyridine |
| SMILES | C#Cc1nc(C)cc(C)c1C |
| InChI | InChI=1S/C10H11N/c1-5-10-9(4)7(2)6-8(3)11-10/h1,6H,2-4H3 |
| InChIKey | PARNHQNBKYYHPG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-3,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-3,4,6-trimethylpyridine?
The IUPAC name of 2-ethynyl-3,4,6-trimethylpyridine (CID 122593451) is 2-ethynyl-3,4,6-trimethylpyridine.
What is the SMILES notation for 2-ethynyl-3,4,6-trimethylpyridine?
The canonical SMILES for 2-ethynyl-3,4,6-trimethylpyridine is C#Cc1nc(C)cc(C)c1C.
What is the InChIKey of 2-ethynyl-3,4,6-trimethylpyridine?
The InChIKey is PARNHQNBKYYHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-5-10-9(4)7(2)6-8(3)11-10/h1,6H,2-4H3.
What are the key properties of 2-ethynyl-3,4,6-trimethylpyridine?
2-ethynyl-3,4,6-trimethylpyridine has a molecular weight of 145.20 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-3,4,6-trimethylpyridine is sourced from PubChem (CID 122593451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).