About 5-tert-butyl-7H-indolo[2,3-b]carbazole
5-tert-butyl-7H-indolo[2,3-b]carbazole (PubChem CID 122593552) has the molecular formula C22H20N2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-tert-butyl-7H-indolo[2,3-b]carbazole.
Molecular Properties
| Compound Name | 5-tert-butyl-7H-indolo[2,3-b]carbazole |
| PubChem CID | 122593552 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-tert-butyl-7H-indolo[2,3-b]carbazole |
| SMILES | CC(C)(C)n1c2ccccc2c2cc3c(cc21)[nH]c1ccccc13 |
| InChI | InChI=1S/C22H20N2/c1-22(2,3)24-20-11-7-5-9-15(20)17-12-16-14-8-4-6-10-18(14)23-19(16)13-21(17)24/h4-13,23H,1-3H3 |
| InChIKey | ZDGUPGACKXGMFW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-7H-indolo[2,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-7H-indolo[2,3-b]carbazole?
The IUPAC name of 5-tert-butyl-7H-indolo[2,3-b]carbazole (CID 122593552) is 5-tert-butyl-7H-indolo[2,3-b]carbazole.
What is the SMILES notation for 5-tert-butyl-7H-indolo[2,3-b]carbazole?
The canonical SMILES for 5-tert-butyl-7H-indolo[2,3-b]carbazole is CC(C)(C)n1c2ccccc2c2cc3c(cc21)[nH]c1ccccc13.
What is the InChIKey of 5-tert-butyl-7H-indolo[2,3-b]carbazole?
The InChIKey is ZDGUPGACKXGMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2/c1-22(2,3)24-20-11-7-5-9-15(20)17-12-16-14-8-4-6-10-18(14)23-19(16)13-21(17)24/h4-13,23H,1-3H3.
What are the key properties of 5-tert-butyl-7H-indolo[2,3-b]carbazole?
5-tert-butyl-7H-indolo[2,3-b]carbazole has a molecular weight of 312.42 g/mol, XLogP of 6.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-7H-indolo[2,3-b]carbazole is sourced from PubChem (CID 122593552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).