About 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole
2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole (PubChem CID 122593756) has the molecular formula C36H22N6O
and a molecular weight of 554.61 g/mol. Its IUPAC name is 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole |
| PubChem CID | 122593756 |
| Molecular Formula | C36H22N6O |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole |
| SMILES | c1cncc(-n2c3ccccc3c3ccc(-c4nnc(-c5ccc6c7ccccc7n(-c7cccnc7)c6c5)o4)cc32)c1 |
| InChI | InChI=1S/C36H22N6O/c1-3-11-31-27(9-1)29-15-13-23(19-33(29)41(31)25-7-5-17-37-21-25)35-39-40-36(43-35)24-14-16-30-28-10-2-4-12-32(28)42(34(30)20-24)26-8-6-18-38-22-26/h1-22H |
| InChIKey | HGDAVUISXNATBL-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole?
The IUPAC name of 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole (CID 122593756) is 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole is c1cncc(-n2c3ccccc3c3ccc(-c4nnc(-c5ccc6c7ccccc7n(-c7cccnc7)c6c5)o4)cc32)c1.
What is the InChIKey of 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole?
The InChIKey is HGDAVUISXNATBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H22N6O/c1-3-11-31-27(9-1)29-15-13-23(19-33(29)41(31)25-7-5-17-37-21-25)35-39-40-36(43-35)24-14-16-30-28-10-2-4-12-32(28)42(34(30)20-24)26-8-6-18-38-22-26/h1-22H.
What are the key properties of 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole?
2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole has a molecular weight of 554.61 g/mol, XLogP of 8.39, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(9-pyridin-3-ylcarbazol-2-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 122593756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).