C50H34N4S — CID 122593926
N,3-diphenyl-N-[4-[5-[9-(3-phenylphenyl)carbazol-2-yl]-1,3,4-thiadiazol-2-yl]phenyl]aniline (PubChem CID 122593926) has the molecular formula C50H34N4S and a molecular weight of 722.92 g/mol. Its IUPAC name is N,3-diphenyl-N-[4-[5-[9-(3-phenylphenyl)carbazol-2-yl]-1,3,4-thiadiazol-2-yl]phenyl]aniline.
| Compound Name | N,3-diphenyl-N-[4-[5-[9-(3-phenylphenyl)carbazol-2-yl]-1,3,4-thiadiazol-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 122593926 |
| Molecular Formula | C50H34N4S |
| Molecular Weight | 722.92 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | N,3-diphenyl-N-[4-[5-[9-(3-phenylphenyl)carbazol-2-yl]-1,3,4-thiadiazol-2-yl]phenyl]aniline |
| SMILES | c1ccc(-c2cccc(N(c3ccccc3)c3ccc(-c4nnc(-c5ccc6c7ccccc7n(-c7cccc(-c8ccccc8)c7)c6c5)s4)cc3)c2)cc1 |
| InChI | InChI=1S/C50H34N4S/c1-4-14-35(15-5-1)38-18-12-22-43(32-38)53(41-20-8-3-9-21-41)42-29-26-37(27-30-42)49-51-52-50(55-49)40-28-31-46-45-24-10-11-25-47(45)54(48(46)34-40)44-23-13-19-39(33-44)36-16-6-2-7-17-36/h1-34H |
| InChIKey | LRTOHQVINFUPSI-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.92 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |