C56H34N10S — CID 122593954
2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-2-yl]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-4-yl]-1,3,4-thiadiazole (PubChem CID 122593954) has the molecular formula C56H34N10S and a molecular weight of 879.03 g/mol. Its IUPAC name is 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-2-yl]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-4-yl]-1,3,4-thiadiazole.
| Compound Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-2-yl]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-4-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 122593954 |
| Molecular Formula | C56H34N10S |
| Molecular Weight | 879.03 g/mol |
| Exact Mass | 878.27 |
| IUPAC Name | 2-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-2-yl]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-4-yl]-1,3,4-thiadiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccc(-c5nnc(-c6cccc7c6c6ccccc6n7-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)s5)cc43)n2)cc1 |
| InChI | InChI=1S/C56H34N10S/c1-5-18-35(19-6-1)49-57-50(36-20-7-2-8-21-36)60-55(59-49)65-45-30-16-14-27-42(45)48-43(28-17-31-46(48)65)54-64-63-53(67-54)39-32-33-41-40-26-13-15-29-44(40)66(47(41)34-39)56-61-51(37-22-9-3-10-23-37)58-52(62-56)38-24-11-4-12-25-38/h1-34H |
| InChIKey | XZUOQCLYXRDITJ-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 112.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.03 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |