C19H27F3O2 — CID 122594326
(1,1,1-trifluoro-2,6-dimethyloct-7-en-2-yl) 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 122594326) has the molecular formula C19H27F3O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is (1,1,1-trifluoro-2,6-dimethyloct-7-en-2-yl) 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1,1,1-trifluoro-2,6-dimethyloct-7-en-2-yl) 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 122594326 |
| Molecular Formula | C19H27F3O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (1,1,1-trifluoro-2,6-dimethyloct-7-en-2-yl) 3-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C=CC(C)CCCC(C)(OC(=O)C1C2C=CC(C2)C1C)C(F)(F)F |
| InChI | InChI=1S/C19H27F3O2/c1-5-12(2)7-6-10-18(4,19(20,21)22)24-17(23)16-13(3)14-8-9-15(16)11-14/h5,8-9,12-16H,1,6-7,10-11H2,2-4H3 |
| InChIKey | OKQNSPURZRPBLM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|