C21H29F3O2 — CID 122594327
5-[2-[2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethoxy]-1,1,1-trifluoropropan-2-yl]oxyethyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 122594327) has the molecular formula C21H29F3O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[2-[2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethoxy]-1,1,1-trifluoropropan-2-yl]oxyethyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[2-[2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethoxy]-1,1,1-trifluoropropan-2-yl]oxyethyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 122594327 |
| Molecular Formula | C21H29F3O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 5-[2-[2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethoxy]-1,1,1-trifluoropropan-2-yl]oxyethyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | CC(OCCC1CC2C=CC1C2)(OCCC1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C21H29F3O2/c1-20(21(22,23)24,25-8-6-18-12-14-2-4-16(18)10-14)26-9-7-19-13-15-3-5-17(19)11-15/h2-5,14-19H,6-13H2,1H3 |
| InChIKey | NRPSGZWTNVPBPC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|