C34H41F3O2 — CID 122594484
2,2,2-trifluoroethyl 6-(4-tert-butylphenyl)-2,2-dimethyl-4,4-diphenyloctanoate (PubChem CID 122594484) has the molecular formula C34H41F3O2 and a molecular weight of 538.69 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 6-(4-tert-butylphenyl)-2,2-dimethyl-4,4-diphenyloctanoate.
| Compound Name | 2,2,2-trifluoroethyl 6-(4-tert-butylphenyl)-2,2-dimethyl-4,4-diphenyloctanoate |
|---|---|
| PubChem CID | 122594484 |
| Molecular Formula | C34H41F3O2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 2,2,2-trifluoroethyl 6-(4-tert-butylphenyl)-2,2-dimethyl-4,4-diphenyloctanoate |
| SMILES | CCC(CC(CC(C)(C)C(=O)OCC(F)(F)F)(c1ccccc1)c1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H41F3O2/c1-7-25(26-18-20-27(21-19-26)31(2,3)4)22-33(28-14-10-8-11-15-28,29-16-12-9-13-17-29)23-32(5,6)30(38)39-24-34(35,36)37/h8-21,25H,7,22-24H2,1-6H3 |
| InChIKey | IJKVNWQKKKWEHX-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |