C18H18ClN3O3S2 — CID 122594560
1-[2-chloro-5-(5-thiophen-2-yl-1H-imidazol-2-yl)phenyl]sulfonylpiperidin-4-ol (PubChem CID 122594560) has the molecular formula C18H18ClN3O3S2 and a molecular weight of 423.95 g/mol. Its IUPAC name is 1-[2-chloro-5-(5-thiophen-2-yl-1H-imidazol-2-yl)phenyl]sulfonylpiperidin-4-ol.
| Compound Name | 1-[2-chloro-5-(5-thiophen-2-yl-1H-imidazol-2-yl)phenyl]sulfonylpiperidin-4-ol |
|---|---|
| PubChem CID | 122594560 |
| Molecular Formula | C18H18ClN3O3S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 1-[2-chloro-5-(5-thiophen-2-yl-1H-imidazol-2-yl)phenyl]sulfonylpiperidin-4-ol |
| SMILES | O=S(=O)(c1cc(-c2ncc(-c3cccs3)[nH]2)ccc1Cl)N1CCC(O)CC1 |
| InChI | InChI=1S/C18H18ClN3O3S2/c19-14-4-3-12(18-20-11-15(21-18)16-2-1-9-26-16)10-17(14)27(24,25)22-7-5-13(23)6-8-22/h1-4,9-11,13,23H,5-8H2,(H,20,21) |
| InChIKey | HAYOWANYYYYVQA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |