C16H15F13 — CID 122595025
4-ethenyl-1-prop-1-enyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopentane (PubChem CID 122595025) has the molecular formula C16H15F13 and a molecular weight of 454.27 g/mol. Its IUPAC name is 4-ethenyl-1-prop-1-enyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopentane.
| Compound Name | 4-ethenyl-1-prop-1-enyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopentane |
|---|---|
| PubChem CID | 122595025 |
| Molecular Formula | C16H15F13 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 4-ethenyl-1-prop-1-enyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclopentane |
| SMILES | C=CC1CC(C=CC)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H15F13/c1-3-5-9-6-8(4-2)7-10(9)11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h3-5,8-10H,2,6-7H2,1H3 |
| InChIKey | IVZKGLOQSHRGSV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|